
CAS٪3a٪7b٪7b0٪7d٪7d ٪7c Isopropyl Carbamate
Molecular Formula:C4H9NO2
Molecular Weight:103.12
Purity:98 percent
Package:100g/250g/500g/1kg/bulk package
- دنیا بھر میں ترسیل
- کوالٹی اشورینس
- 24/7 کسٹمر سروس
مصنوعات کا تعارف
Isopropyl carbamate has many applications in scientific research. It is used in the synthesis of pharmaceuticals, such as anti-cancer drugs, antibiotics, and anti-inflammatory drugs. Additionally, it is used in the production of polymers, such as polyurethanes, polycarbonates, and polyesters. It is also used in the manufacture of pesticides and rubber products. Isopropyl carbamate is also used in the production of plastics and other materials.
|
|
|
| propan-2-yl carbamate | |
| MFCD00025463 | |
| 1.01g/cm3 | |
| 183ºC | |
| 52.32 | |
| 1.19 | |
| InChI=1S/C4H9NO2/c1-3(2)7-4(5)6/h3H,1-2H3,(H2,5,6) | |
| OVPLZYJGTGDFNB-UHFFFAOYSA-N |

ڈاؤن لوڈ، اتارنا ٹیگ: cas:1746-77-6|isopropyl carbamate, price, quotation, discount, in stock, for sale






